C22H35IN6 — CID 111416070
1-ethyl-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111416070) has the molecular formula C22H35IN6 and a molecular weight of 510.47 g/mol. Its IUPAC name is 1-ethyl-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111416070 |
| Molecular Formula | C22H35IN6 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 1-ethyl-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(Cn2ccnc2C)c1)NCCN1CCCCC1.I |
| InChI | InChI=1S/C22H34N6.HI/c1-3-23-22(25-10-14-27-12-5-4-6-13-27)26-17-20-8-7-9-21(16-20)18-28-15-11-24-19(28)2;/h7-9,11,15-16H,3-6,10,12-14,17-18H2,1-2H3,(H2,23,25,26);1H |
| InChIKey | XWHGNHFWSQWLOD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|