C24H30IN5O2 — CID 111380086
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111380086) has the molecular formula C24H30IN5O2 and a molecular weight of 547.44 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111380086 |
| Molecular Formula | C24H30IN5O2 |
| Molecular Weight | 547.44 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(Cn2ccnc2C)c1)NCCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C24H29N5O2.HI/c1-3-25-24(27-10-9-19-7-8-22-23(14-19)31-17-30-22)28-15-20-5-4-6-21(13-20)16-29-12-11-26-18(29)2;/h4-8,11-14H,3,9-10,15-17H2,1-2H3,(H2,25,27,28);1H |
| InChIKey | PPNNUQKIHJAASL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|