C23H28IN5O2 — CID 111379166
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111379166) has the molecular formula C23H28IN5O2 and a molecular weight of 533.41 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111379166 |
| Molecular Formula | C23H28IN5O2 |
| Molecular Weight | 533.41 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1Cn1cccn1)NCCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C23H27N5O2.HI/c1-2-24-23(25-12-10-18-8-9-21-22(14-18)30-17-29-21)26-15-19-6-3-4-7-20(19)16-28-13-5-11-27-28;/h3-9,11,13-14H,2,10,12,15-17H2,1H3,(H2,24,25,26);1H |
| InChIKey | OBYUWEHYOXSIGJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|