C18H26IN5O2 — CID 111379294
2-[2-(1,3-benzodioxol-5-yl)ethyl]-1-ethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111379294) has the molecular formula C18H26IN5O2 and a molecular weight of 471.34 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)ethyl]-1-ethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)ethyl]-1-ethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111379294 |
| Molecular Formula | C18H26IN5O2 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)ethyl]-1-ethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc2c(c1)OCO2)NCCc1cnn(C)c1.I |
| InChI | InChI=1S/C18H25N5O2.HI/c1-3-19-18(21-9-7-15-11-22-23(2)12-15)20-8-6-14-4-5-16-17(10-14)25-13-24-16;/h4-5,10-12H,3,6-9,13H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | NACDCMXMWVSDPC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|