C19H27N5O — CID 75423791
2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-1-ethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine (PubChem CID 75423791) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is 2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-1-ethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine.
| Compound Name | 2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-1-ethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 75423791 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-1-ethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1ccc2c(c1)CCO2)NCCc1cnn(C)c1 |
| InChI | InChI=1S/C19H27N5O/c1-3-20-19(22-10-7-16-13-23-24(2)14-16)21-9-6-15-4-5-18-17(12-15)8-11-25-18/h4-5,12-14H,3,6-11H2,1-2H3,(H2,20,21,22) |
| InChIKey | RLIVTMCUSLDDDR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|