C18H28IN5O2S — CID 111613915
1-ethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]-2-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111613915) has the molecular formula C18H28IN5O2S and a molecular weight of 505.43 g/mol. Its IUPAC name is 1-ethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]-2-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]-2-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111613915 |
| Molecular Formula | C18H28IN5O2S |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 1-ethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]-2-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(S(C)(=O)=O)cc1)NCCc1cnn(C)c1.I |
| InChI | InChI=1S/C18H27N5O2S.HI/c1-4-19-18(21-12-10-16-13-22-23(2)14-16)20-11-9-15-5-7-17(8-6-15)26(3,24)25;/h5-8,13-14H,4,9-12H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | DBFBHQKILAJZMF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|