C19H27IN4O2S — CID 111613015
1-ethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-2-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111613015) has the molecular formula C19H27IN4O2S and a molecular weight of 502.42 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-2-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-2-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111613015 |
| Molecular Formula | C19H27IN4O2S |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 1-ethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-2-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccccn1)NCCc1ccc(S(C)(=O)=O)cc1.I |
| InChI | InChI=1S/C19H26N4O2S.HI/c1-3-20-19(23-15-12-17-6-4-5-13-21-17)22-14-11-16-7-9-18(10-8-16)26(2,24)25;/h4-10,13H,3,11-12,14-15H2,1-2H3,(H2,20,22,23);1H |
| InChIKey | KZSWOCJJHRSAJA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|