C21H29N3O3S — CID 111614344
1-ethyl-2-[2-(2-methoxyphenyl)ethyl]-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine (PubChem CID 111614344) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-methoxyphenyl)ethyl]-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(2-methoxyphenyl)ethyl]-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111614344 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 1-ethyl-2-[2-(2-methoxyphenyl)ethyl]-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1ccccc1OC)NCCc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H29N3O3S/c1-4-22-21(24-16-14-18-7-5-6-8-20(18)27-2)23-15-13-17-9-11-19(12-10-17)28(3,25)26/h5-12H,4,13-16H2,1-3H3,(H2,22,23,24) |
| InChIKey | CXMXYVPXNZYFQE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|