C13H20IN3O2 — CID 111379966
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-methylguanidine;hydroiodide (PubChem CID 111379966) has the molecular formula C13H20IN3O2 and a molecular weight of 377.23 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111379966 |
| Molecular Formula | C13H20IN3O2 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\C)NCCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C13H19N3O2.HI/c1-3-15-13(14-2)16-7-6-10-4-5-11-12(8-10)18-9-17-11;/h4-5,8H,3,6-7,9H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | DXKIWVGMOMQDKY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|