C14H20IN3O2 — CID 110933628
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-cyclopropyl-2-methylguanidine;hydroiodide (PubChem CID 110933628) has the molecular formula C14H20IN3O2 and a molecular weight of 389.24 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-cyclopropyl-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-cyclopropyl-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110933628 |
| Molecular Formula | C14H20IN3O2 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-cyclopropyl-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc2c(c1)OCO2)NC1CC1.I |
| InChI | InChI=1S/C14H19N3O2.HI/c1-15-14(17-11-3-4-11)16-7-6-10-2-5-12-13(8-10)19-9-18-12;/h2,5,8,11H,3-4,6-7,9H2,1H3,(H2,15,16,17);1H |
| InChIKey | LXQJQQDKLWEJCD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|