C17H26IN3O — CID 111826609
1-cyclopentyl-3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111826609) has the molecular formula C17H26IN3O and a molecular weight of 415.32 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-cyclopentyl-3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111826609 |
| Molecular Formula | C17H26IN3O |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 1-cyclopentyl-3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc2c(c1)CCO2)NC1CCCC1.I |
| InChI | InChI=1S/C17H25N3O.HI/c1-18-17(20-15-4-2-3-5-15)19-10-8-13-6-7-16-14(12-13)9-11-21-16;/h6-7,12,15H,2-5,8-11H2,1H3,(H2,18,19,20);1H |
| InChIKey | CZUYPFGOIXZJSK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|