C22H34N4O2 — CID 111563934
N-cyclohexyl-3-[[[2-(2,3-dihydro-1-benzofuran-5-yl)ethylamino]-(ethylamino)methylidene]amino]propanamide (PubChem CID 111563934) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is N-cyclohexyl-3-[[[2-(2,3-dihydro-1-benzofuran-5-yl)ethylamino]-(ethylamino)methylidene]amino]propanamide.
| Compound Name | N-cyclohexyl-3-[[[2-(2,3-dihydro-1-benzofuran-5-yl)ethylamino]-(ethylamino)methylidene]amino]propanamide |
|---|---|
| PubChem CID | 111563934 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | N-cyclohexyl-3-[[[2-(2,3-dihydro-1-benzofuran-5-yl)ethylamino]-(ethylamino)methylidene]amino]propanamide |
| SMILES | CCN/C(=N\CCC(=O)NC1CCCCC1)NCCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C22H34N4O2/c1-2-23-22(25-14-11-21(27)26-19-6-4-3-5-7-19)24-13-10-17-8-9-20-18(16-17)12-15-28-20/h8-9,16,19H,2-7,10-15H2,1H3,(H,26,27)(H2,23,24,25) |
| InChIKey | NEZNGWROXDOEEJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|