C23H28IN3O2 — CID 111563705
1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-methyl-3-[2-(4-prop-2-ynoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111563705) has the molecular formula C23H28IN3O2 and a molecular weight of 505.40 g/mol. Its IUPAC name is 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-methyl-3-[2-(4-prop-2-ynoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-methyl-3-[2-(4-prop-2-ynoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111563705 |
| Molecular Formula | C23H28IN3O2 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-methyl-3-[2-(4-prop-2-ynoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C#CCOc1ccc(CCN/C(=N\C)NCCc2ccc3c(c2)CCO3)cc1.I |
| InChI | InChI=1S/C23H27N3O2.HI/c1-3-15-27-21-7-4-18(5-8-21)10-13-25-23(24-2)26-14-11-19-6-9-22-20(17-19)12-16-28-22;/h1,4-9,17H,10-16H2,2H3,(H2,24,25,26);1H |
| InChIKey | MBVANQPQQVFFPA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|