C21H26F2IN3O2 — CID 111562517
1-[[3-(2,2-difluoroethoxy)phenyl]methyl]-3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111562517) has the molecular formula C21H26F2IN3O2 and a molecular weight of 517.36 g/mol. Its IUPAC name is 1-[[3-(2,2-difluoroethoxy)phenyl]methyl]-3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[3-(2,2-difluoroethoxy)phenyl]methyl]-3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111562517 |
| Molecular Formula | C21H26F2IN3O2 |
| Molecular Weight | 517.36 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | 1-[[3-(2,2-difluoroethoxy)phenyl]methyl]-3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc2c(c1)CCO2)NCc1cccc(OCC(F)F)c1.I |
| InChI | InChI=1S/C21H25F2N3O2.HI/c1-24-21(25-9-7-15-5-6-19-17(11-15)8-10-27-19)26-13-16-3-2-4-18(12-16)28-14-20(22)23;/h2-6,11-12,20H,7-10,13-14H2,1H3,(H2,24,25,26);1H |
| InChIKey | WHBRIUNAFXBDGQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|