C19H24N4O3S — CID 111562242
1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine (PubChem CID 111562242) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111562242 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCCc1ccc2c(c1)CCO2)NCc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C19H24N4O3S/c1-21-19(23-13-15-3-2-4-17(12-15)27(20,24)25)22-9-7-14-5-6-18-16(11-14)8-10-26-18/h2-6,11-12H,7-10,13H2,1H3,(H2,20,24,25)(H2,21,22,23) |
| InChIKey | WNGSVLNHIBVSJX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|