C21H31IN4O4S — CID 111245880
1-[2-(3,4-diethoxyphenyl)ethyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111245880) has the molecular formula C21H31IN4O4S and a molecular weight of 562.47 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111245880 |
| Molecular Formula | C21H31IN4O4S |
| Molecular Weight | 562.47 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCOc1ccc(CCN/C(=N/C)NCc2cccc(S(N)(=O)=O)c2)cc1OCC.I |
| InChI | InChI=1S/C21H30N4O4S.HI/c1-4-28-19-10-9-16(14-20(19)29-5-2)11-12-24-21(23-3)25-15-17-7-6-8-18(13-17)30(22,26)27;/h6-10,13-14H,4-5,11-12,15H2,1-3H3,(H2,22,26,27)(H2,23,24,25);1H |
| InChIKey | HBOVUJYUMUDZOA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|