C19H27N3O2S — CID 111245595
1-[2-(3,4-diethoxyphenyl)ethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111245595) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111245595 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | CCOc1ccc(CCN/C(=N/C)NCc2cccs2)cc1OCC |
| InChI | InChI=1S/C19H27N3O2S/c1-4-23-17-9-8-15(13-18(17)24-5-2)10-11-21-19(20-3)22-14-16-7-6-12-25-16/h6-9,12-13H,4-5,10-11,14H2,1-3H3,(H2,20,21,22) |
| InChIKey | UNCHDLDZBWRJFK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|