C18H26IN3O3S — CID 111258704
1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111258704) has the molecular formula C18H26IN3O3S and a molecular weight of 491.40 g/mol. Its IUPAC name is 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111258704 |
| Molecular Formula | C18H26IN3O3S |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCOc1c(OC)cc(CN/C(=N/C)NCc2cccs2)cc1OC.I |
| InChI | InChI=1S/C18H25N3O3S.HI/c1-5-24-17-15(22-3)9-13(10-16(17)23-4)11-20-18(19-2)21-12-14-7-6-8-25-14;/h6-10H,5,11-12H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | MKQYXMKHKHAKGW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|