C23H29IN4O4 — CID 111553406
1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111553406) has the molecular formula C23H29IN4O4 and a molecular weight of 552.41 g/mol. Its IUPAC name is 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111553406 |
| Molecular Formula | C23H29IN4O4 |
| Molecular Weight | 552.41 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCOc1c(OC)cc(CN/C(=N/C)NCc2coc(-c3ccccc3)n2)cc1OC.I |
| InChI | InChI=1S/C23H28N4O4.HI/c1-5-30-21-19(28-3)11-16(12-20(21)29-4)13-25-23(24-2)26-14-18-15-31-22(27-18)17-9-7-6-8-10-17;/h6-12,15H,5,13-14H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | CZAVIOWDIJPZHL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|