C19H22IN5O2 — CID 111552846
1-[(2-methoxy-3-pyridinyl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111552846) has the molecular formula C19H22IN5O2 and a molecular weight of 479.32 g/mol. Its IUPAC name is 1-[(2-methoxy-3-pyridinyl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-methoxy-3-pyridinyl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111552846 |
| Molecular Formula | C19H22IN5O2 |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 1-[(2-methoxy-3-pyridinyl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1coc(-c2ccccc2)n1)NCc1cccnc1OC.I |
| InChI | InChI=1S/C19H21N5O2.HI/c1-20-19(22-11-15-9-6-10-21-17(15)25-2)23-12-16-13-26-18(24-16)14-7-4-3-5-8-14;/h3-10,13H,11-12H2,1-2H3,(H2,20,22,23);1H |
| InChIKey | CEGXNZIVZFXGHP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|