C22H22IN5O — CID 111980770
2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-(quinolin-4-ylmethyl)guanidine;hydroiodide (PubChem CID 111980770) has the molecular formula C22H22IN5O and a molecular weight of 499.36 g/mol. Its IUPAC name is 2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-(quinolin-4-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-(quinolin-4-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111980770 |
| Molecular Formula | C22H22IN5O |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | 2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-(quinolin-4-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1coc(-c2ccccc2)n1)NCc1ccnc2ccccc12.I |
| InChI | InChI=1S/C22H21N5O.HI/c1-23-22(25-13-17-11-12-24-20-10-6-5-9-19(17)20)26-14-18-15-28-21(27-18)16-7-3-2-4-8-16;/h2-12,15H,13-14H2,1H3,(H2,23,25,26);1H |
| InChIKey | ALCYDQMBGKIEGF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|