C16H18IN5O2 — CID 75425227
2-methyl-1-(1,2-oxazol-3-ylmethyl)-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 75425227) has the molecular formula C16H18IN5O2 and a molecular weight of 439.26 g/mol. Its IUPAC name is 2-methyl-1-(1,2-oxazol-3-ylmethyl)-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(1,2-oxazol-3-ylmethyl)-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 75425227 |
| Molecular Formula | C16H18IN5O2 |
| Molecular Weight | 439.26 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 2-methyl-1-(1,2-oxazol-3-ylmethyl)-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccon1)NCc1coc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C16H17N5O2.HI/c1-17-16(18-9-13-7-8-23-21-13)19-10-14-11-22-15(20-14)12-5-3-2-4-6-12;/h2-8,11H,9-10H2,1H3,(H2,17,18,19);1H |
| InChIKey | UNHCBYWUESCOSF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|