C22H32IN3O3 — CID 111938200
1-[(2,4-dimethylphenyl)methyl]-3-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111938200) has the molecular formula C22H32IN3O3 and a molecular weight of 513.42 g/mol. Its IUPAC name is 1-[(2,4-dimethylphenyl)methyl]-3-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2,4-dimethylphenyl)methyl]-3-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111938200 |
| Molecular Formula | C22H32IN3O3 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 1-[(2,4-dimethylphenyl)methyl]-3-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOc1c(OC)cc(CN/C(=N/C)NCc2ccc(C)cc2C)cc1OC.I |
| InChI | InChI=1S/C22H31N3O3.HI/c1-7-28-21-19(26-5)11-17(12-20(21)27-6)13-24-22(23-4)25-14-18-9-8-15(2)10-16(18)3;/h8-12H,7,13-14H2,1-6H3,(H2,23,24,25);1H |
| InChIKey | ORNWHVSRQTZOQW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|