C13H22IN3 — CID 111937740
1-[(2,4-dimethylphenyl)methyl]-3-ethyl-2-methylguanidine;hydroiodide (PubChem CID 111937740) has the molecular formula C13H22IN3 and a molecular weight of 347.24 g/mol. Its IUPAC name is 1-[(2,4-dimethylphenyl)methyl]-3-ethyl-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2,4-dimethylphenyl)methyl]-3-ethyl-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111937740 |
| Molecular Formula | C13H22IN3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-[(2,4-dimethylphenyl)methyl]-3-ethyl-2-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\C)NCc1ccc(C)cc1C.I |
| InChI | InChI=1S/C13H21N3.HI/c1-5-15-13(14-4)16-9-12-7-6-10(2)8-11(12)3;/h6-8H,5,9H2,1-4H3,(H2,14,15,16);1H |
| InChIKey | PGBRLAILTAAOBL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|