C17H25IN4S — CID 111535509
1-[(2,4-dimethylphenyl)methyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111535509) has the molecular formula C17H25IN4S and a molecular weight of 444.39 g/mol. Its IUPAC name is 1-[(2,4-dimethylphenyl)methyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2,4-dimethylphenyl)methyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111535509 |
| Molecular Formula | C17H25IN4S |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 1-[(2,4-dimethylphenyl)methyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1cnc(CN/C(=N\C)NCc2ccc(C)cc2C)s1.I |
| InChI | InChI=1S/C17H24N4S.HI/c1-5-15-10-19-16(22-15)11-21-17(18-4)20-9-14-7-6-12(2)8-13(14)3;/h6-8,10H,5,9,11H2,1-4H3,(H2,18,20,21);1H |
| InChIKey | XGNZHUOSPNKMRO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|