C17H26IN5O2S2 — CID 111534012
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide (PubChem CID 111534012) has the molecular formula C17H26IN5O2S2 and a molecular weight of 523.47 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111534012 |
| Molecular Formula | C17H26IN5O2S2 |
| Molecular Weight | 523.47 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
| SMILES | CCc1cnc(CN/C(=N\C)NCCNS(=O)(=O)c2ccc(C)cc2)s1.I |
| InChI | InChI=1S/C17H25N5O2S2.HI/c1-4-14-11-20-16(25-14)12-21-17(18-3)19-9-10-22-26(23,24)15-7-5-13(2)6-8-15;/h5-8,11,22H,4,9-10,12H2,1-3H3,(H2,18,19,21);1H |
| InChIKey | SYWCLZUWUQBTJE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|