C14H27N5O2S2 — CID 111535893
1-[3-[ethyl(methylsulfonyl)amino]propyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine (PubChem CID 111535893) has the molecular formula C14H27N5O2S2 and a molecular weight of 361.54 g/mol. Its IUPAC name is 1-[3-[ethyl(methylsulfonyl)amino]propyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[3-[ethyl(methylsulfonyl)amino]propyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111535893 |
| Molecular Formula | C14H27N5O2S2 |
| Molecular Weight | 361.54 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 1-[3-[ethyl(methylsulfonyl)amino]propyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine |
| SMILES | CCc1cnc(CN/C(=N/C)NCCCN(CC)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C14H27N5O2S2/c1-5-12-10-17-13(22-12)11-18-14(15-3)16-8-7-9-19(6-2)23(4,20)21/h10H,5-9,11H2,1-4H3,(H2,15,16,18) |
| InChIKey | VVVLYCVBKPXSKA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.54 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|