C16H29N5OS — CID 111534886
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(4-morpholin-4-ylbutyl)guanidine (PubChem CID 111534886) has the molecular formula C16H29N5OS and a molecular weight of 339.51 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(4-morpholin-4-ylbutyl)guanidine.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(4-morpholin-4-ylbutyl)guanidine |
|---|---|
| PubChem CID | 111534886 |
| Molecular Formula | C16H29N5OS |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(4-morpholin-4-ylbutyl)guanidine |
| SMILES | CCc1cnc(CN/C(=N\C)NCCCCN2CCOCC2)s1 |
| InChI | InChI=1S/C16H29N5OS/c1-3-14-12-19-15(23-14)13-20-16(17-2)18-6-4-5-7-21-8-10-22-11-9-21/h12H,3-11,13H2,1-2H3,(H2,17,18,20) |
| InChIKey | XBUIIVONXWUHRF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|