C20H29FN6S — CID 111533879
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-methylguanidine (PubChem CID 111533879) has the molecular formula C20H29FN6S and a molecular weight of 404.56 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-methylguanidine.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111533879 |
| Molecular Formula | C20H29FN6S |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-methylguanidine |
| SMILES | CCc1cnc(CN/C(=N\C)NCCN2CCN(c3ccc(F)cc3)CC2)s1 |
| InChI | InChI=1S/C20H29FN6S/c1-3-18-14-24-19(28-18)15-25-20(22-2)23-8-9-26-10-12-27(13-11-26)17-6-4-16(21)5-7-17/h4-7,14H,3,8-13,15H2,1-2H3,(H2,22,23,25) |
| InChIKey | SNJDCWGJFVMDCV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|