C18H28N8S — CID 111534248
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine (PubChem CID 111534248) has the molecular formula C18H28N8S and a molecular weight of 388.55 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111534248 |
| Molecular Formula | C18H28N8S |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
| SMILES | CCc1cnc(CN/C(=N\C)NCCN2CCN(c3ncccn3)CC2)s1 |
| InChI | InChI=1S/C18H28N8S/c1-3-15-13-23-16(27-15)14-24-17(19-2)20-7-8-25-9-11-26(12-10-25)18-21-5-4-6-22-18/h4-6,13H,3,7-12,14H2,1-2H3,(H2,19,20,24) |
| InChIKey | LPPFWVDFYYFFBY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|