C16H31IN6S — CID 111533926
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 111533926) has the molecular formula C16H31IN6S and a molecular weight of 466.44 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111533926 |
| Molecular Formula | C16H31IN6S |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCc1cnc(CN/C(=N\C)NCCN2CCCN(C)CC2)s1.I |
| InChI | InChI=1S/C16H30N6S.HI/c1-4-14-12-19-15(23-14)13-20-16(17-2)18-6-9-22-8-5-7-21(3)10-11-22;/h12H,4-11,13H2,1-3H3,(H2,17,18,20);1H |
| InChIKey | MPNXPQUUGOZHGA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|