C19H34N6O2S — CID 111535871
tert-butyl 4-[2-[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]piperazine-1-carboxylate (PubChem CID 111535871) has the molecular formula C19H34N6O2S and a molecular weight of 410.59 g/mol. Its IUPAC name is tert-butyl 4-[2-[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111535871 |
| Molecular Formula | C19H34N6O2S |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | tert-butyl 4-[2-[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]piperazine-1-carboxylate |
| SMILES | CCc1cnc(CN/C(=N\C)NCCN2CCN(C(=O)OC(C)(C)C)CC2)s1 |
| InChI | InChI=1S/C19H34N6O2S/c1-6-15-13-22-16(28-15)14-23-17(20-5)21-7-8-24-9-11-25(12-10-24)18(26)27-19(2,3)4/h13H,6-12,14H2,1-5H3,(H2,20,21,23) |
| InChIKey | WKYGTEPYALGKDG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|