C19H33N5O2S — CID 111535030
tert-butyl 2-[[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 111535030) has the molecular formula C19H33N5O2S and a molecular weight of 395.57 g/mol. Its IUPAC name is tert-butyl 2-[[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111535030 |
| Molecular Formula | C19H33N5O2S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | tert-butyl 2-[[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CCc1cnc(CN/C(=N\C)NCC2CCCCN2C(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C19H33N5O2S/c1-6-15-12-21-16(27-15)13-23-17(20-5)22-11-14-9-7-8-10-24(14)18(25)26-19(2,3)4/h12,14H,6-11,13H2,1-5H3,(H2,20,22,23) |
| InChIKey | MUYXLSRSUCLJMF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|