C19H32N4O3 — CID 111354628
tert-butyl 2-[[[N-[2-(furan-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 111354628) has the molecular formula C19H32N4O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is tert-butyl 2-[[[N-[2-(furan-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[[N-[2-(furan-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111354628 |
| Molecular Formula | C19H32N4O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | tert-butyl 2-[[[N-[2-(furan-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | C/N=C(\NCCc1ccco1)NCC1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H32N4O3/c1-19(2,3)26-18(24)23-12-6-5-8-15(23)14-22-17(20-4)21-11-10-16-9-7-13-25-16/h7,9,13,15H,5-6,8,10-12,14H2,1-4H3,(H2,20,21,22) |
| InChIKey | VLZCWOWZLCICQI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|