C18H30N2O3 — CID 106633307
tert-butyl 2-[[1-(furan-2-yl)propan-2-ylamino]methyl]piperidine-1-carboxylate (PubChem CID 106633307) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is tert-butyl 2-[[1-(furan-2-yl)propan-2-ylamino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[1-(furan-2-yl)propan-2-ylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 106633307 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | tert-butyl 2-[[1-(furan-2-yl)propan-2-ylamino]methyl]piperidine-1-carboxylate |
| SMILES | CC(Cc1ccco1)NCC1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H30N2O3/c1-14(12-16-9-7-11-22-16)19-13-15-8-5-6-10-20(15)17(21)23-18(2,3)4/h7,9,11,14-15,19H,5-6,8,10,12-13H2,1-4H3 |
| InChIKey | VDCMMEQAXNBOHK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |