C17H35N3O2 — CID 104864390
tert-butyl 2-[[4-(dimethylamino)butan-2-ylamino]methyl]piperidine-1-carboxylate (PubChem CID 104864390) has the molecular formula C17H35N3O2 and a molecular weight of 313.49 g/mol. Its IUPAC name is tert-butyl 2-[[4-(dimethylamino)butan-2-ylamino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[4-(dimethylamino)butan-2-ylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 104864390 |
| Molecular Formula | C17H35N3O2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.27 |
| IUPAC Name | tert-butyl 2-[[4-(dimethylamino)butan-2-ylamino]methyl]piperidine-1-carboxylate |
| SMILES | CC(CCN(C)C)NCC1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H35N3O2/c1-14(10-12-19(5)6)18-13-15-9-7-8-11-20(15)16(21)22-17(2,3)4/h14-15,18H,7-13H2,1-6H3 |
| InChIKey | PRVRLHFXWZDRCD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |