C18H36N2O2 — CID 106632952
tert-butyl 2-[(5-methylhexan-2-ylamino)methyl]piperidine-1-carboxylate (PubChem CID 106632952) has the molecular formula C18H36N2O2 and a molecular weight of 312.50 g/mol. Its IUPAC name is tert-butyl 2-[(5-methylhexan-2-ylamino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(5-methylhexan-2-ylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 106632952 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | tert-butyl 2-[(5-methylhexan-2-ylamino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)CCC(C)NCC1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H36N2O2/c1-14(2)10-11-15(3)19-13-16-9-7-8-12-20(16)17(21)22-18(4,5)6/h14-16,19H,7-13H2,1-6H3 |
| InChIKey | SRCBPGLMFWGXGL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |