C18H37N3O2 — CID 103879002
tert-butyl 2-[2-[1-(dimethylamino)propan-2-ylamino]propyl]piperidine-1-carboxylate (PubChem CID 103879002) has the molecular formula C18H37N3O2 and a molecular weight of 327.51 g/mol. Its IUPAC name is tert-butyl 2-[2-[1-(dimethylamino)propan-2-ylamino]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[1-(dimethylamino)propan-2-ylamino]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103879002 |
| Molecular Formula | C18H37N3O2 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | tert-butyl 2-[2-[1-(dimethylamino)propan-2-ylamino]propyl]piperidine-1-carboxylate |
| SMILES | CC(CC1CCCCN1C(=O)OC(C)(C)C)NC(C)CN(C)C |
| InChI | InChI=1S/C18H37N3O2/c1-14(19-15(2)13-20(6)7)12-16-10-8-9-11-21(16)17(22)23-18(3,4)5/h14-16,19H,8-13H2,1-7H3 |
| InChIKey | OZQJKLHTDORKCI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |