C18H31N3O4 — CID 113248704
tert-butyl 2-[2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]piperidine-1-carboxylate (PubChem CID 113248704) has the molecular formula C18H31N3O4 and a molecular weight of 353.46 g/mol. Its IUPAC name is tert-butyl 2-[2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113248704 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | tert-butyl 2-[2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]piperidine-1-carboxylate |
| SMILES | CC(CC1CCCCN1C(=O)OC(C)(C)C)NC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C18H31N3O4/c1-12(19-14-11-15(22)20(5)16(14)23)10-13-8-6-7-9-21(13)17(24)25-18(2,3)4/h12-14,19H,6-11H2,1-5H3 |
| InChIKey | MTTILIIFIRYTKH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|