C17H31N3O3 — CID 106182504
tert-butyl 2-[2-[(5-oxopyrrolidin-3-yl)amino]propyl]piperidine-1-carboxylate (PubChem CID 106182504) has the molecular formula C17H31N3O3 and a molecular weight of 325.45 g/mol. Its IUPAC name is tert-butyl 2-[2-[(5-oxopyrrolidin-3-yl)amino]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[(5-oxopyrrolidin-3-yl)amino]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 106182504 |
| Molecular Formula | C17H31N3O3 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | tert-butyl 2-[2-[(5-oxopyrrolidin-3-yl)amino]propyl]piperidine-1-carboxylate |
| SMILES | CC(CC1CCCCN1C(=O)OC(C)(C)C)NC1CNC(=O)C1 |
| InChI | InChI=1S/C17H31N3O3/c1-12(19-13-10-15(21)18-11-13)9-14-7-5-6-8-20(14)16(22)23-17(2,3)4/h12-14,19H,5-11H2,1-4H3,(H,18,21) |
| InChIKey | ATYBJWNWDJLOTJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |