C18H34N2O3 — CID 104871958
tert-butyl 2-[2-[(2-methyloxan-4-yl)amino]propyl]pyrrolidine-1-carboxylate (PubChem CID 104871958) has the molecular formula C18H34N2O3 and a molecular weight of 326.48 g/mol. Its IUPAC name is tert-butyl 2-[2-[(2-methyloxan-4-yl)amino]propyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[(2-methyloxan-4-yl)amino]propyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 104871958 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | tert-butyl 2-[2-[(2-methyloxan-4-yl)amino]propyl]pyrrolidine-1-carboxylate |
| SMILES | CC(CC1CCCN1C(=O)OC(C)(C)C)NC1CCOC(C)C1 |
| InChI | InChI=1S/C18H34N2O3/c1-13(19-15-8-10-22-14(2)12-15)11-16-7-6-9-20(16)17(21)23-18(3,4)5/h13-16,19H,6-12H2,1-5H3 |
| InChIKey | ZNLDUYOFGMHGQZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |