C17H27NO4 — CID 97175846
tert-butyl (2R)-2-[[(1R)-1-(furan-2-yl)ethoxy]methyl]piperidine-1-carboxylate (PubChem CID 97175846) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[(1R)-1-(furan-2-yl)ethoxy]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[(1R)-1-(furan-2-yl)ethoxy]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97175846 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | tert-butyl (2R)-2-[[(1R)-1-(furan-2-yl)ethoxy]methyl]piperidine-1-carboxylate |
| SMILES | C[C@@H](OC[C@H]1CCCCN1C(=O)OC(C)(C)C)c1ccco1 |
| InChI | InChI=1S/C17H27NO4/c1-13(15-9-7-11-20-15)21-12-14-8-5-6-10-18(14)16(19)22-17(2,3)4/h7,9,11,13-14H,5-6,8,10,12H2,1-4H3/t13-,14-/m1/s1 |
| InChIKey | MHXHDKNJVHSCEH-ZIAGYGMSSA-N |
| XLogP | 4.15 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |