C16H25N3O3 — CID 97175905
tert-butyl (2R)-2-[[(1S)-1-pyrazin-2-ylethoxy]methyl]pyrrolidine-1-carboxylate (PubChem CID 97175905) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[(1S)-1-pyrazin-2-ylethoxy]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[(1S)-1-pyrazin-2-ylethoxy]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 97175905 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | tert-butyl (2R)-2-[[(1S)-1-pyrazin-2-ylethoxy]methyl]pyrrolidine-1-carboxylate |
| SMILES | C[C@H](OC[C@H]1CCCN1C(=O)OC(C)(C)C)c1cnccn1 |
| InChI | InChI=1S/C16H25N3O3/c1-12(14-10-17-7-8-18-14)21-11-13-6-5-9-19(13)15(20)22-16(2,3)4/h7-8,10,12-13H,5-6,9,11H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | BMQXTPQIESHPQZ-QWHCGFSZSA-N |
| XLogP | 2.95 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |