C19H31N3O3 — CID 97176061
tert-butyl 4-[3-[(1S)-1-pyrazin-2-ylethoxy]propyl]piperidine-1-carboxylate (PubChem CID 97176061) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is tert-butyl 4-[3-[(1S)-1-pyrazin-2-ylethoxy]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(1S)-1-pyrazin-2-ylethoxy]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97176061 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | tert-butyl 4-[3-[(1S)-1-pyrazin-2-ylethoxy]propyl]piperidine-1-carboxylate |
| SMILES | C[C@H](OCCCC1CCN(C(=O)OC(C)(C)C)CC1)c1cnccn1 |
| InChI | InChI=1S/C19H31N3O3/c1-15(17-14-20-9-10-21-17)24-13-5-6-16-7-11-22(12-8-16)18(23)25-19(2,3)4/h9-10,14-16H,5-8,11-13H2,1-4H3/t15-/m0/s1 |
| InChIKey | VHLXARNAFJSFNX-HNNXBMFYSA-N |
| XLogP | 3.98 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|