C20H32N2O3 — CID 97176060
tert-butyl 4-[3-[(1R)-1-pyridin-2-ylethoxy]propyl]piperidine-1-carboxylate (PubChem CID 97176060) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is tert-butyl 4-[3-[(1R)-1-pyridin-2-ylethoxy]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(1R)-1-pyridin-2-ylethoxy]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97176060 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | tert-butyl 4-[3-[(1R)-1-pyridin-2-ylethoxy]propyl]piperidine-1-carboxylate |
| SMILES | C[C@@H](OCCCC1CCN(C(=O)OC(C)(C)C)CC1)c1ccccn1 |
| InChI | InChI=1S/C20H32N2O3/c1-16(18-9-5-6-12-21-18)24-15-7-8-17-10-13-22(14-11-17)19(23)25-20(2,3)4/h5-6,9,12,16-17H,7-8,10-11,13-15H2,1-4H3/t16-/m1/s1 |
| InChIKey | LXXZINSCVNOQKM-MRXNPFEDSA-N |
| XLogP | 4.59 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|