C18H30N2O3 — CID 97175994
tert-butyl 4-[2-[(1R)-1-(1H-pyrrol-2-yl)ethoxy]ethyl]piperidine-1-carboxylate (PubChem CID 97175994) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is tert-butyl 4-[2-[(1R)-1-(1H-pyrrol-2-yl)ethoxy]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(1R)-1-(1H-pyrrol-2-yl)ethoxy]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97175994 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | tert-butyl 4-[2-[(1R)-1-(1H-pyrrol-2-yl)ethoxy]ethyl]piperidine-1-carboxylate |
| SMILES | C[C@@H](OCCC1CCN(C(=O)OC(C)(C)C)CC1)c1ccc[nH]1 |
| InChI | InChI=1S/C18H30N2O3/c1-14(16-6-5-10-19-16)22-13-9-15-7-11-20(12-8-15)17(21)23-18(2,3)4/h5-6,10,14-15,19H,7-9,11-13H2,1-4H3/t14-/m1/s1 |
| InChIKey | XNTOGKHIEQJRCO-CQSZACIVSA-N |
| XLogP | 4.13 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |