C15H25N3O2 — CID 97175641
tert-butyl 4-[(1R)-1-(1H-pyrrol-2-yl)ethyl]piperazine-1-carboxylate (PubChem CID 97175641) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is tert-butyl 4-[(1R)-1-(1H-pyrrol-2-yl)ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1R)-1-(1H-pyrrol-2-yl)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 97175641 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | tert-butyl 4-[(1R)-1-(1H-pyrrol-2-yl)ethyl]piperazine-1-carboxylate |
| SMILES | C[C@H](c1ccc[nH]1)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H25N3O2/c1-12(13-6-5-7-16-13)17-8-10-18(11-9-17)14(19)20-15(2,3)4/h5-7,12,16H,8-11H2,1-4H3/t12-/m1/s1 |
| InChIKey | XWSDULPUIVYOQD-GFCCVEGCSA-N |
| XLogP | 2.63 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |