C16H27N3O2 — CID 97175743
tert-butyl (3S)-3-[[[(1S)-1-(1H-pyrrol-2-yl)ethyl]amino]methyl]pyrrolidine-1-carboxylate (PubChem CID 97175743) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[[(1S)-1-(1H-pyrrol-2-yl)ethyl]amino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[[(1S)-1-(1H-pyrrol-2-yl)ethyl]amino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 97175743 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | tert-butyl (3S)-3-[[[(1S)-1-(1H-pyrrol-2-yl)ethyl]amino]methyl]pyrrolidine-1-carboxylate |
| SMILES | C[C@H](NC[C@@H]1CCN(C(=O)OC(C)(C)C)C1)c1ccc[nH]1 |
| InChI | InChI=1S/C16H27N3O2/c1-12(14-6-5-8-17-14)18-10-13-7-9-19(11-13)15(20)21-16(2,3)4/h5-6,8,12-13,17-18H,7,9-11H2,1-4H3/t12-,13-/m0/s1 |
| InChIKey | UYPIHKXCVSGEQQ-STQMWFEESA-N |
| XLogP | 2.92 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |