C19H32N2O3 — CID 97176008
tert-butyl (2R)-2-[3-[(1R)-1-(1H-pyrrol-2-yl)ethoxy]propyl]piperidine-1-carboxylate (PubChem CID 97176008) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is tert-butyl (2R)-2-[3-[(1R)-1-(1H-pyrrol-2-yl)ethoxy]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[3-[(1R)-1-(1H-pyrrol-2-yl)ethoxy]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97176008 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | tert-butyl (2R)-2-[3-[(1R)-1-(1H-pyrrol-2-yl)ethoxy]propyl]piperidine-1-carboxylate |
| SMILES | C[C@@H](OCCC[C@H]1CCCCN1C(=O)OC(C)(C)C)c1ccc[nH]1 |
| InChI | InChI=1S/C19H32N2O3/c1-15(17-11-7-12-20-17)23-14-8-10-16-9-5-6-13-21(16)18(22)24-19(2,3)4/h7,11-12,15-16,20H,5-6,8-10,13-14H2,1-4H3/t15-,16-/m1/s1 |
| InChIKey | KHVCCZRWIMVEDB-HZPDHXFCSA-N |
| XLogP | 4.66 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|