C18H29N3O3 — CID 97176825
tert-butyl (2S)-2-[3-(4-methylpyrimidin-2-yl)oxypropyl]piperidine-1-carboxylate (PubChem CID 97176825) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-(4-methylpyrimidin-2-yl)oxypropyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[3-(4-methylpyrimidin-2-yl)oxypropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97176825 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | tert-butyl (2S)-2-[3-(4-methylpyrimidin-2-yl)oxypropyl]piperidine-1-carboxylate |
| SMILES | Cc1ccnc(OCCC[C@@H]2CCCCN2C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C18H29N3O3/c1-14-10-11-19-16(20-14)23-13-7-9-15-8-5-6-12-21(15)17(22)24-18(2,3)4/h10-11,15H,5-9,12-13H2,1-4H3/t15-/m0/s1 |
| InChIKey | AXIADUAXUXHEHM-HNNXBMFYSA-N |
| XLogP | 3.73 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|